C23H20ClFN3O+ — CID 7031432
7-[(S)-(2-chloro-6-fluorophenyl)-[(6-methylpyridin-1-ium-2-yl)amino]methyl]-2-methylquinolin-8-ol (PubChem CID 7031432) has the molecular formula C23H20ClFN3O+ and a molecular weight of 408.88 g/mol. Its IUPAC name is 7-[(S)-(2-chloro-6-fluorophenyl)-[(6-methylpyridin-1-ium-2-yl)amino]methyl]-2-methylquinolin-8-ol.
| Compound Name | 7-[(S)-(2-chloro-6-fluorophenyl)-[(6-methylpyridin-1-ium-2-yl)amino]methyl]-2-methylquinolin-8-ol |
|---|---|
| PubChem CID | 7031432 |
| Molecular Formula | C23H20ClFN3O+ |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 7-[(S)-(2-chloro-6-fluorophenyl)-[(6-methylpyridin-1-ium-2-yl)amino]methyl]-2-methylquinolin-8-ol |
| SMILES | Cc1ccc2ccc([C@H](Nc3cccc(C)[nH+]3)c3c(F)cccc3Cl)c(O)c2n1 |
| InChI | InChI=1S/C23H19ClFN3O/c1-13-5-3-8-19(26-13)28-22(20-17(24)6-4-7-18(20)25)16-12-11-15-10-9-14(2)27-21(15)23(16)29/h3-12,22,29H,1-2H3,(H,26,28)/p+1/t22-/m0/s1 |
| InChIKey | MDOMBJYHRLLVTB-QFIPXVFZSA-O |
| XLogP | 5.37 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|