C23H16Cl3FN2O — CID 19233032
7-[(4-fluorophenyl)-(2,4,5-trichloroanilino)methyl]-2-methylquinolin-8-ol (PubChem CID 19233032) has the molecular formula C23H16Cl3FN2O and a molecular weight of 461.75 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)-(2,4,5-trichloroanilino)methyl]-2-methylquinolin-8-ol.
| Compound Name | 7-[(4-fluorophenyl)-(2,4,5-trichloroanilino)methyl]-2-methylquinolin-8-ol |
|---|---|
| PubChem CID | 19233032 |
| Molecular Formula | C23H16Cl3FN2O |
| Molecular Weight | 461.75 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 7-[(4-fluorophenyl)-(2,4,5-trichloroanilino)methyl]-2-methylquinolin-8-ol |
| SMILES | Cc1ccc2ccc(C(Nc3cc(Cl)c(Cl)cc3Cl)c3ccc(F)cc3)c(O)c2n1 |
| InChI | InChI=1S/C23H16Cl3FN2O/c1-12-2-3-14-6-9-16(23(30)22(14)28-12)21(13-4-7-15(27)8-5-13)29-20-11-18(25)17(24)10-19(20)26/h2-11,21,29-30H,1H3 |
| InChIKey | DCUCVYCWOXBAOJ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.75 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|