C21H15Cl3N2O2 — CID 19233031
7-[furan-2-yl-(2,4,5-trichloroanilino)methyl]-2-methylquinolin-8-ol (PubChem CID 19233031) has the molecular formula C21H15Cl3N2O2 and a molecular weight of 433.72 g/mol. Its IUPAC name is 7-[furan-2-yl-(2,4,5-trichloroanilino)methyl]-2-methylquinolin-8-ol.
| Compound Name | 7-[furan-2-yl-(2,4,5-trichloroanilino)methyl]-2-methylquinolin-8-ol |
|---|---|
| PubChem CID | 19233031 |
| Molecular Formula | C21H15Cl3N2O2 |
| Molecular Weight | 433.72 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 7-[furan-2-yl-(2,4,5-trichloroanilino)methyl]-2-methylquinolin-8-ol |
| SMILES | Cc1ccc2ccc(C(Nc3cc(Cl)c(Cl)cc3Cl)c3ccco3)c(O)c2n1 |
| InChI | InChI=1S/C21H15Cl3N2O2/c1-11-4-5-12-6-7-13(21(27)19(12)25-11)20(18-3-2-8-28-18)26-17-10-15(23)14(22)9-16(17)24/h2-10,20,26-27H,1H3 |
| InChIKey | ZMTOAOJZERKIST-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.72 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|