C18H14N4O2 — CID 703337
7-[(S)-furan-2-yl-(pyrimidin-2-ylamino)methyl]quinolin-8-ol (PubChem CID 703337) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 7-[(S)-furan-2-yl-(pyrimidin-2-ylamino)methyl]quinolin-8-ol.
| Compound Name | 7-[(S)-furan-2-yl-(pyrimidin-2-ylamino)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 703337 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 7-[(S)-furan-2-yl-(pyrimidin-2-ylamino)methyl]quinolin-8-ol |
| SMILES | Oc1c([C@H](Nc2ncccn2)c2ccco2)ccc2cccnc12 |
| InChI | InChI=1S/C18H14N4O2/c23-17-13(7-6-12-4-1-8-19-15(12)17)16(14-5-2-11-24-14)22-18-20-9-3-10-21-18/h1-11,16,23H,(H,20,21,22)/t16-/m0/s1 |
| InChIKey | QSDHABQFUBXYAT-INIZCTEOSA-N |
| XLogP | 3.52 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|