C20H17N3O4S — CID 19233159
4-[[furan-2-yl-(8-hydroxyquinolin-7-yl)methyl]amino]benzenesulfonamide (PubChem CID 19233159) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is 4-[[furan-2-yl-(8-hydroxyquinolin-7-yl)methyl]amino]benzenesulfonamide.
| Compound Name | 4-[[furan-2-yl-(8-hydroxyquinolin-7-yl)methyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 19233159 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-[[furan-2-yl-(8-hydroxyquinolin-7-yl)methyl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NC(c2ccco2)c2ccc3cccnc3c2O)cc1 |
| InChI | InChI=1S/C20H17N3O4S/c21-28(25,26)15-8-6-14(7-9-15)23-19(17-4-2-12-27-17)16-10-5-13-3-1-11-22-18(13)20(16)24/h1-12,19,23-24H,(H2,21,25,26) |
| InChIKey | NFMANSCQNMFEEW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|