C20H14Cl2N2O2 — CID 4073581
7-[(2,4-dichloroanilino)-(furan-2-yl)methyl]quinolin-8-ol (PubChem CID 4073581) has the molecular formula C20H14Cl2N2O2 and a molecular weight of 385.25 g/mol. Its IUPAC name is 7-[(2,4-dichloroanilino)-(furan-2-yl)methyl]quinolin-8-ol.
| Compound Name | 7-[(2,4-dichloroanilino)-(furan-2-yl)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 4073581 |
| Molecular Formula | C20H14Cl2N2O2 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 7-[(2,4-dichloroanilino)-(furan-2-yl)methyl]quinolin-8-ol |
| SMILES | Oc1c(C(Nc2ccc(Cl)cc2Cl)c2ccco2)ccc2cccnc12 |
| InChI | InChI=1S/C20H14Cl2N2O2/c21-13-6-8-16(15(22)11-13)24-19(17-4-2-10-26-17)14-7-5-12-3-1-9-23-18(12)20(14)25/h1-11,19,24-25H |
| InChIKey | OKRWIZKAETVVII-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|