C21H14ClN5O — CID 175998762
2-chloro-3-[(8-hydroxyquinolin-7-yl)-(pyrimidin-2-ylamino)methyl]benzonitrile (PubChem CID 175998762) has the molecular formula C21H14ClN5O and a molecular weight of 387.83 g/mol. Its IUPAC name is 2-chloro-3-[(8-hydroxyquinolin-7-yl)-(pyrimidin-2-ylamino)methyl]benzonitrile.
| Compound Name | 2-chloro-3-[(8-hydroxyquinolin-7-yl)-(pyrimidin-2-ylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 175998762 |
| Molecular Formula | C21H14ClN5O |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-chloro-3-[(8-hydroxyquinolin-7-yl)-(pyrimidin-2-ylamino)methyl]benzonitrile |
| SMILES | N#Cc1cccc(C(Nc2ncccn2)c2ccc3cccnc3c2O)c1Cl |
| InChI | InChI=1S/C21H14ClN5O/c22-17-14(12-23)4-1-6-15(17)19(27-21-25-10-3-11-26-21)16-8-7-13-5-2-9-24-18(13)20(16)28/h1-11,19,28H,(H,25,26,27) |
| InChIKey | WKMXJBYMNRKNEM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|