C24H21ClN4O — CID 176554015
2-chloro-3-[(8-hydroxyquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzonitrile;ethane (PubChem CID 176554015) has the molecular formula C24H21ClN4O and a molecular weight of 416.91 g/mol. Its IUPAC name is 2-chloro-3-[(8-hydroxyquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzonitrile;ethane.
| Compound Name | 2-chloro-3-[(8-hydroxyquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzonitrile;ethane |
|---|---|
| PubChem CID | 176554015 |
| Molecular Formula | C24H21ClN4O |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-chloro-3-[(8-hydroxyquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzonitrile;ethane |
| SMILES | CC.N#Cc1cccc(C(Nc2ccccn2)c2ccc3cccnc3c2O)c1Cl |
| InChI | InChI=1S/C22H15ClN4O.C2H6/c23-19-15(13-24)5-3-7-16(19)21(27-18-8-1-2-11-25-18)17-10-9-14-6-4-12-26-20(14)22(17)28;1-2/h1-12,21,28H,(H,25,27);1-2H3 |
| InChIKey | SEWOEAOPNFVVJG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|