C23H21N3O — CID 1222215
7-[(S)-(4-ethylphenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol (PubChem CID 1222215) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is 7-[(S)-(4-ethylphenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol.
| Compound Name | 7-[(S)-(4-ethylphenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 1222215 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 7-[(S)-(4-ethylphenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
| SMILES | CCc1ccc([C@H](Nc2ccccn2)c2ccc3cccnc3c2O)cc1 |
| InChI | InChI=1S/C23H21N3O/c1-2-16-8-10-18(11-9-16)21(26-20-7-3-4-14-24-20)19-13-12-17-6-5-15-25-22(17)23(19)27/h3-15,21,27H,2H2,1H3,(H,24,26)/t21-/m0/s1 |
| InChIKey | GKKHBDOWRWTQKO-NRFANRHFSA-N |
| XLogP | 5.10 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|