C21H15Cl2N3O — CID 67987463
7-[(3,5-dichlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol (PubChem CID 67987463) has the molecular formula C21H15Cl2N3O and a molecular weight of 396.28 g/mol. Its IUPAC name is 7-[(3,5-dichlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol.
| Compound Name | 7-[(3,5-dichlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 67987463 |
| Molecular Formula | C21H15Cl2N3O |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 7-[(3,5-dichlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
| SMILES | Oc1c(C(Nc2ccccn2)c2cc(Cl)cc(Cl)c2)ccc2cccnc12 |
| InChI | InChI=1S/C21H15Cl2N3O/c22-15-10-14(11-16(23)12-15)19(26-18-5-1-2-8-24-18)17-7-6-13-4-3-9-25-20(13)21(17)27/h1-12,19,27H,(H,24,26) |
| InChIKey | YJRXOKKNHTYAKR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|