C23H16FN3O3S — CID 146474846
3-ethynyl-5-[(8-hydroxyquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzenesulfonyl fluoride (PubChem CID 146474846) has the molecular formula C23H16FN3O3S and a molecular weight of 433.46 g/mol. Its IUPAC name is 3-ethynyl-5-[(8-hydroxyquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzenesulfonyl fluoride.
| Compound Name | 3-ethynyl-5-[(8-hydroxyquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 146474846 |
| Molecular Formula | C23H16FN3O3S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 3-ethynyl-5-[(8-hydroxyquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzenesulfonyl fluoride |
| SMILES | C#Cc1cc(C(Nc2ccccn2)c2ccc3cccnc3c2O)cc(S(=O)(=O)F)c1 |
| InChI | InChI=1S/C23H16FN3O3S/c1-2-15-12-17(14-18(13-15)31(24,29)30)21(27-20-7-3-4-10-25-20)19-9-8-16-6-5-11-26-22(16)23(19)28/h1,3-14,21,28H,(H,25,27) |
| InChIKey | QVDKJYYUBCJDCO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|