C20H17N3OS — CID 1228836
7-[(R)-(5-methylthiophen-2-yl)-(pyridin-2-ylamino)methyl]quinolin-8-ol (PubChem CID 1228836) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is 7-[(R)-(5-methylthiophen-2-yl)-(pyridin-2-ylamino)methyl]quinolin-8-ol.
| Compound Name | 7-[(R)-(5-methylthiophen-2-yl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 1228836 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 7-[(R)-(5-methylthiophen-2-yl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
| SMILES | Cc1ccc([C@H](Nc2ccccn2)c2ccc3cccnc3c2O)s1 |
| InChI | InChI=1S/C20H17N3OS/c1-13-7-10-16(25-13)19(23-17-6-2-3-11-21-17)15-9-8-14-5-4-12-22-18(14)20(15)24/h2-12,19,24H,1H3,(H,21,23)/t19-/m1/s1 |
| InChIKey | HFGMIGJDJWLJDQ-LJQANCHMSA-N |
| XLogP | 4.91 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|