C21H15ClFN3O — CID 40547635
7-[(S)-(2-chloro-6-fluorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol (PubChem CID 40547635) has the molecular formula C21H15ClFN3O and a molecular weight of 379.82 g/mol. Its IUPAC name is 7-[(S)-(2-chloro-6-fluorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol.
| Compound Name | 7-[(S)-(2-chloro-6-fluorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 40547635 |
| Molecular Formula | C21H15ClFN3O |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 7-[(S)-(2-chloro-6-fluorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
| SMILES | Oc1c([C@H](Nc2ccccn2)c2c(F)cccc2Cl)ccc2cccnc12 |
| InChI | InChI=1S/C21H15ClFN3O/c22-15-6-3-7-16(23)18(15)20(26-17-8-1-2-11-24-17)14-10-9-13-5-4-12-25-19(13)21(14)27/h1-12,20,27H,(H,24,26)/t20-/m0/s1 |
| InChIKey | YROVRAVZEVZWSW-FQEVSTJZSA-N |
| XLogP | 5.33 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|