C22H18BrN3O2 — CID 26366116
7-[(R)-(3-bromo-4-methoxyphenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol (PubChem CID 26366116) has the molecular formula C22H18BrN3O2 and a molecular weight of 436.31 g/mol. Its IUPAC name is 7-[(R)-(3-bromo-4-methoxyphenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol.
| Compound Name | 7-[(R)-(3-bromo-4-methoxyphenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 26366116 |
| Molecular Formula | C22H18BrN3O2 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 7-[(R)-(3-bromo-4-methoxyphenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
| SMILES | COc1ccc([C@@H](Nc2ccccn2)c2ccc3cccnc3c2O)cc1Br |
| InChI | InChI=1S/C22H18BrN3O2/c1-28-18-10-8-15(13-17(18)23)20(26-19-6-2-3-11-24-19)16-9-7-14-5-4-12-25-21(14)22(16)27/h2-13,20,27H,1H3,(H,24,26)/t20-/m1/s1 |
| InChIKey | BOCKEIWBRVBKDM-HXUWFJFHSA-N |
| XLogP | 5.31 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|