C24H23N3O4 — CID 162668822
7-[(4-hydroxy-3,5-dimethoxyphenyl)-[(5-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol (PubChem CID 162668822) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 7-[(4-hydroxy-3,5-dimethoxyphenyl)-[(5-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol.
| Compound Name | 7-[(4-hydroxy-3,5-dimethoxyphenyl)-[(5-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 162668822 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 7-[(4-hydroxy-3,5-dimethoxyphenyl)-[(5-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol |
| SMILES | COc1cc(C(Nc2ccc(C)cn2)c2ccc3cccnc3c2O)cc(OC)c1O |
| InChI | InChI=1S/C24H23N3O4/c1-14-6-9-20(26-13-14)27-21(16-11-18(30-2)24(29)19(12-16)31-3)17-8-7-15-5-4-10-25-22(15)23(17)28/h4-13,21,28-29H,1-3H3,(H,26,27) |
| InChIKey | MITSWHDEOSTHCR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|