C26H26ClN3O3 — CID 2221476
7-[(R)-(3-chloro-4,5-diethoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol (PubChem CID 2221476) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is 7-[(R)-(3-chloro-4,5-diethoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol.
| Compound Name | 7-[(R)-(3-chloro-4,5-diethoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 2221476 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 7-[(R)-(3-chloro-4,5-diethoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol |
| SMILES | CCOc1cc([C@@H](Nc2cc(C)ccn2)c2ccc3cccnc3c2O)cc(Cl)c1OCC |
| InChI | InChI=1S/C26H26ClN3O3/c1-4-32-21-15-18(14-20(27)26(21)33-5-2)23(30-22-13-16(3)10-12-28-22)19-9-8-17-7-6-11-29-24(17)25(19)31/h6-15,23,31H,4-5H2,1-3H3,(H,28,30)/t23-/m1/s1 |
| InChIKey | QLIQUSKEWKIJDK-HSZRJFAPSA-N |
| XLogP | 6.30 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|