C22H16Cl3N3O — CID 58542856
7-[[(5-chloro-4-methyl-2-pyridinyl)amino]-(3,5-dichlorophenyl)methyl]quinolin-8-ol (PubChem CID 58542856) has the molecular formula C22H16Cl3N3O and a molecular weight of 444.75 g/mol. Its IUPAC name is 7-[[(5-chloro-4-methyl-2-pyridinyl)amino]-(3,5-dichlorophenyl)methyl]quinolin-8-ol.
| Compound Name | 7-[[(5-chloro-4-methyl-2-pyridinyl)amino]-(3,5-dichlorophenyl)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 58542856 |
| Molecular Formula | C22H16Cl3N3O |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 7-[[(5-chloro-4-methyl-2-pyridinyl)amino]-(3,5-dichlorophenyl)methyl]quinolin-8-ol |
| SMILES | Cc1cc(NC(c2cc(Cl)cc(Cl)c2)c2ccc3cccnc3c2O)ncc1Cl |
| InChI | InChI=1S/C22H16Cl3N3O/c1-12-7-19(27-11-18(12)25)28-20(14-8-15(23)10-16(24)9-14)17-5-4-13-3-2-6-26-21(13)22(17)29/h2-11,20,29H,1H3,(H,27,28) |
| InChIKey | KYFOROOFSWMLIX-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|