C25H24ClN3O3 — CID 1303334
7-[(R)-(3-chloro-4,5-dimethoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol (PubChem CID 1303334) has the molecular formula C25H24ClN3O3 and a molecular weight of 449.94 g/mol. Its IUPAC name is 7-[(R)-(3-chloro-4,5-dimethoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol.
| Compound Name | 7-[(R)-(3-chloro-4,5-dimethoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol |
|---|---|
| PubChem CID | 1303334 |
| Molecular Formula | C25H24ClN3O3 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 7-[(R)-(3-chloro-4,5-dimethoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol |
| SMILES | COc1cc([C@@H](Nc2cc(C)ccn2)c2ccc3ccc(C)nc3c2O)cc(Cl)c1OC |
| InChI | InChI=1S/C25H24ClN3O3/c1-14-9-10-27-21(11-14)29-22(17-12-19(26)25(32-4)20(13-17)31-3)18-8-7-16-6-5-15(2)28-23(16)24(18)30/h5-13,22,30H,1-4H3,(H,27,29)/t22-/m1/s1 |
| InChIKey | BITXZZNWWHVZPE-JOCHJYFZSA-N |
| XLogP | 5.82 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|