C24H23N3O2 — CID 1020375
7-[(R)-(3-methoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol (PubChem CID 1020375) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 7-[(R)-(3-methoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol.
| Compound Name | 7-[(R)-(3-methoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol |
|---|---|
| PubChem CID | 1020375 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 7-[(R)-(3-methoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol |
| SMILES | COc1cccc([C@@H](Nc2cc(C)ccn2)c2ccc3ccc(C)nc3c2O)c1 |
| InChI | InChI=1S/C24H23N3O2/c1-15-11-12-25-21(13-15)27-22(18-5-4-6-19(14-18)29-3)20-10-9-17-8-7-16(2)26-23(17)24(20)28/h4-14,22,28H,1-3H3,(H,25,27)/t22-/m1/s1 |
| InChIKey | FEQPLAMQCMIQNR-JOCHJYFZSA-N |
| XLogP | 5.16 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|