C23H20BrN3O — CID 2944009
7-[(3-bromophenyl)-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol (PubChem CID 2944009) has the molecular formula C23H20BrN3O and a molecular weight of 434.34 g/mol. Its IUPAC name is 7-[(3-bromophenyl)-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol.
| Compound Name | 7-[(3-bromophenyl)-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol |
|---|---|
| PubChem CID | 2944009 |
| Molecular Formula | C23H20BrN3O |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 7-[(3-bromophenyl)-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol |
| SMILES | Cc1ccnc(NC(c2cccc(Br)c2)c2ccc3ccc(C)nc3c2O)c1 |
| InChI | InChI=1S/C23H20BrN3O/c1-14-10-11-25-20(12-14)27-21(17-4-3-5-18(24)13-17)19-9-8-16-7-6-15(2)26-22(16)23(19)28/h3-13,21,28H,1-2H3,(H,25,27) |
| InChIKey | PZEUMJUWHZCRJQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|