C24H21ClFN3O — CID 90277387
7-[[4-chloro-3-(fluoromethyl)phenyl]-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol (PubChem CID 90277387) has the molecular formula C24H21ClFN3O and a molecular weight of 421.90 g/mol. Its IUPAC name is 7-[[4-chloro-3-(fluoromethyl)phenyl]-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol.
| Compound Name | 7-[[4-chloro-3-(fluoromethyl)phenyl]-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol |
|---|---|
| PubChem CID | 90277387 |
| Molecular Formula | C24H21ClFN3O |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 7-[[4-chloro-3-(fluoromethyl)phenyl]-[(4-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol |
| SMILES | Cc1ccnc(NC(c2ccc(Cl)c(CF)c2)c2ccc3ccc(C)nc3c2O)c1 |
| InChI | InChI=1S/C24H21ClFN3O/c1-14-9-10-27-21(11-14)29-22(17-6-8-20(25)18(12-17)13-26)19-7-5-16-4-3-15(2)28-23(16)24(19)30/h3-12,22,30H,13H2,1-2H3,(H,27,29) |
| InChIKey | MLZZXXJFPBSNGB-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|