C21H19N3OS — CID 1228768
2-methyl-7-[(R)-[(4-methyl-2-pyridinyl)amino]-thiophen-3-ylmethyl]quinolin-8-ol (PubChem CID 1228768) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-methyl-7-[(R)-[(4-methyl-2-pyridinyl)amino]-thiophen-3-ylmethyl]quinolin-8-ol.
| Compound Name | 2-methyl-7-[(R)-[(4-methyl-2-pyridinyl)amino]-thiophen-3-ylmethyl]quinolin-8-ol |
|---|---|
| PubChem CID | 1228768 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-methyl-7-[(R)-[(4-methyl-2-pyridinyl)amino]-thiophen-3-ylmethyl]quinolin-8-ol |
| SMILES | Cc1ccnc(N[C@@H](c2ccsc2)c2ccc3ccc(C)nc3c2O)c1 |
| InChI | InChI=1S/C21H19N3OS/c1-13-7-9-22-18(11-13)24-19(16-8-10-26-12-16)17-6-5-15-4-3-14(2)23-20(15)21(17)25/h3-12,19,25H,1-2H3,(H,22,24)/t19-/m0/s1 |
| InChIKey | YTLGWADVUKISIA-IBGZPJMESA-N |
| XLogP | 5.22 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|