C25H25N3O2 — CID 15993745
7-[(4-methoxy-3-methylphenyl)-[(6-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol (PubChem CID 15993745) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 7-[(4-methoxy-3-methylphenyl)-[(6-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol.
| Compound Name | 7-[(4-methoxy-3-methylphenyl)-[(6-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol |
|---|---|
| PubChem CID | 15993745 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 7-[(4-methoxy-3-methylphenyl)-[(6-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol |
| SMILES | COc1ccc(C(Nc2cccc(C)n2)c2ccc3ccc(C)nc3c2O)cc1C |
| InChI | InChI=1S/C25H25N3O2/c1-15-14-19(11-13-21(15)30-4)23(28-22-7-5-6-16(2)26-22)20-12-10-18-9-8-17(3)27-24(18)25(20)29/h5-14,23,29H,1-4H3,(H,26,28) |
| InChIKey | FPFOOUOUSNGKNM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|