C26H27N3O4 — CID 2940765
2-methyl-7-[[(6-methyl-2-pyridinyl)amino]-(2,3,4-trimethoxyphenyl)methyl]quinolin-8-ol (PubChem CID 2940765) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-methyl-7-[[(6-methyl-2-pyridinyl)amino]-(2,3,4-trimethoxyphenyl)methyl]quinolin-8-ol.
| Compound Name | 2-methyl-7-[[(6-methyl-2-pyridinyl)amino]-(2,3,4-trimethoxyphenyl)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 2940765 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-methyl-7-[[(6-methyl-2-pyridinyl)amino]-(2,3,4-trimethoxyphenyl)methyl]quinolin-8-ol |
| SMILES | COc1ccc(C(Nc2cccc(C)n2)c2ccc3ccc(C)nc3c2O)c(OC)c1OC |
| InChI | InChI=1S/C26H27N3O4/c1-15-7-6-8-21(27-15)29-23(19-13-14-20(31-3)26(33-5)25(19)32-4)18-12-11-17-10-9-16(2)28-22(17)24(18)30/h6-14,23,30H,1-5H3,(H,27,29) |
| InChIKey | PWOPJJWARHVWIL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|