C24H23N3O3 — CID 19233281
7-[(3,4-dimethoxyanilino)-pyridin-4-ylmethyl]-2-methylquinolin-8-ol (PubChem CID 19233281) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 7-[(3,4-dimethoxyanilino)-pyridin-4-ylmethyl]-2-methylquinolin-8-ol.
| Compound Name | 7-[(3,4-dimethoxyanilino)-pyridin-4-ylmethyl]-2-methylquinolin-8-ol |
|---|---|
| PubChem CID | 19233281 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 7-[(3,4-dimethoxyanilino)-pyridin-4-ylmethyl]-2-methylquinolin-8-ol |
| SMILES | COc1ccc(NC(c2ccncc2)c2ccc3ccc(C)nc3c2O)cc1OC |
| InChI | InChI=1S/C24H23N3O3/c1-15-4-5-16-6-8-19(24(28)23(16)26-15)22(17-10-12-25-13-11-17)27-18-7-9-20(29-2)21(14-18)30-3/h4-14,22,27-28H,1-3H3 |
| InChIKey | UMQCLDOEVKQYNB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|