C22H17Cl2N3O — CID 19233228
7-[(3,5-dichloroanilino)-pyridin-3-ylmethyl]-2-methylquinolin-8-ol (PubChem CID 19233228) has the molecular formula C22H17Cl2N3O and a molecular weight of 410.30 g/mol. Its IUPAC name is 7-[(3,5-dichloroanilino)-pyridin-3-ylmethyl]-2-methylquinolin-8-ol.
| Compound Name | 7-[(3,5-dichloroanilino)-pyridin-3-ylmethyl]-2-methylquinolin-8-ol |
|---|---|
| PubChem CID | 19233228 |
| Molecular Formula | C22H17Cl2N3O |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 7-[(3,5-dichloroanilino)-pyridin-3-ylmethyl]-2-methylquinolin-8-ol |
| SMILES | Cc1ccc2ccc(C(Nc3cc(Cl)cc(Cl)c3)c3cccnc3)c(O)c2n1 |
| InChI | InChI=1S/C22H17Cl2N3O/c1-13-4-5-14-6-7-19(22(28)21(14)26-13)20(15-3-2-8-25-12-15)27-18-10-16(23)9-17(24)11-18/h2-12,20,27-28H,1H3 |
| InChIKey | LBNFXNNJMUWXBS-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|