C20H14Cl2N4O — CID 56729926
7-[[(3,5-dichloro-2-pyridinyl)amino]-pyridin-3-ylmethyl]quinolin-8-ol (PubChem CID 56729926) has the molecular formula C20H14Cl2N4O and a molecular weight of 397.27 g/mol. Its IUPAC name is 7-[[(3,5-dichloro-2-pyridinyl)amino]-pyridin-3-ylmethyl]quinolin-8-ol.
| Compound Name | 7-[[(3,5-dichloro-2-pyridinyl)amino]-pyridin-3-ylmethyl]quinolin-8-ol |
|---|---|
| PubChem CID | 56729926 |
| Molecular Formula | C20H14Cl2N4O |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 7-[[(3,5-dichloro-2-pyridinyl)amino]-pyridin-3-ylmethyl]quinolin-8-ol |
| SMILES | Oc1c(C(Nc2ncc(Cl)cc2Cl)c2cccnc2)ccc2cccnc12 |
| InChI | InChI=1S/C20H14Cl2N4O/c21-14-9-16(22)20(25-11-14)26-17(13-4-1-7-23-10-13)15-6-5-12-3-2-8-24-18(12)19(15)27/h1-11,17,27H,(H,25,26) |
| InChIKey | RUGNOTZFDCBPNY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|