C18H14N4OS — CID 1285693
7-[(R)-pyridin-3-yl-(1,3-thiazol-2-ylamino)methyl]quinolin-8-ol (PubChem CID 1285693) has the molecular formula C18H14N4OS and a molecular weight of 334.40 g/mol. Its IUPAC name is 7-[(R)-pyridin-3-yl-(1,3-thiazol-2-ylamino)methyl]quinolin-8-ol.
| Compound Name | 7-[(R)-pyridin-3-yl-(1,3-thiazol-2-ylamino)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 1285693 |
| Molecular Formula | C18H14N4OS |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 7-[(R)-pyridin-3-yl-(1,3-thiazol-2-ylamino)methyl]quinolin-8-ol |
| SMILES | Oc1c([C@H](Nc2nccs2)c2cccnc2)ccc2cccnc12 |
| InChI | InChI=1S/C18H14N4OS/c23-17-14(6-5-12-3-2-8-20-16(12)17)15(13-4-1-7-19-11-13)22-18-21-9-10-24-18/h1-11,15,23H,(H,21,22)/t15-/m1/s1 |
| InChIKey | GRQALDDEXYEUFH-OAHLLOKOSA-N |
| XLogP | 3.99 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|