C23H21BrN3O3+ — CID 7118139
7-[(S)-(3-bromo-4,5-dimethoxyphenyl)-(pyridin-1-ium-2-ylamino)methyl]quinolin-8-ol (PubChem CID 7118139) has the molecular formula C23H21BrN3O3+ and a molecular weight of 467.34 g/mol. Its IUPAC name is 7-[(S)-(3-bromo-4,5-dimethoxyphenyl)-(pyridin-1-ium-2-ylamino)methyl]quinolin-8-ol.
| Compound Name | 7-[(S)-(3-bromo-4,5-dimethoxyphenyl)-(pyridin-1-ium-2-ylamino)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 7118139 |
| Molecular Formula | C23H21BrN3O3+ |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 7-[(S)-(3-bromo-4,5-dimethoxyphenyl)-(pyridin-1-ium-2-ylamino)methyl]quinolin-8-ol |
| SMILES | COc1cc([C@H](Nc2cccc[nH+]2)c2ccc3cccnc3c2O)cc(Br)c1OC |
| InChI | InChI=1S/C23H20BrN3O3/c1-29-18-13-15(12-17(24)23(18)30-2)20(27-19-7-3-4-10-25-19)16-9-8-14-6-5-11-26-21(14)22(16)28/h3-13,20,28H,1-2H3,(H,25,27)/p+1/t20-/m0/s1 |
| InChIKey | YTSQXCDEMAKOKZ-FQEVSTJZSA-O |
| XLogP | 4.74 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|