C21H17ClN3O+ — CID 6980884
7-[(R)-(4-chlorophenyl)-(pyridin-1-ium-2-ylamino)methyl]quinolin-8-ol (PubChem CID 6980884) has the molecular formula C21H17ClN3O+ and a molecular weight of 362.84 g/mol. Its IUPAC name is 7-[(R)-(4-chlorophenyl)-(pyridin-1-ium-2-ylamino)methyl]quinolin-8-ol.
| Compound Name | 7-[(R)-(4-chlorophenyl)-(pyridin-1-ium-2-ylamino)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 6980884 |
| Molecular Formula | C21H17ClN3O+ |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 7-[(R)-(4-chlorophenyl)-(pyridin-1-ium-2-ylamino)methyl]quinolin-8-ol |
| SMILES | Oc1c([C@H](Nc2cccc[nH+]2)c2ccc(Cl)cc2)ccc2cccnc12 |
| InChI | InChI=1S/C21H16ClN3O/c22-16-9-6-15(7-10-16)19(25-18-5-1-2-12-23-18)17-11-8-14-4-3-13-24-20(14)21(17)26/h1-13,19,26H,(H,23,25)/p+1/t19-/m1/s1 |
| InChIKey | RDIURRMJOIJGSL-LJQANCHMSA-O |
| XLogP | 4.61 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|