C19H16N3OS+ — CID 3625041
7-[(pyridin-1-ium-2-ylamino)-thiophen-2-ylmethyl]quinolin-8-ol (PubChem CID 3625041) has the molecular formula C19H16N3OS+ and a molecular weight of 334.42 g/mol. Its IUPAC name is 7-[(pyridin-1-ium-2-ylamino)-thiophen-2-ylmethyl]quinolin-8-ol.
| Compound Name | 7-[(pyridin-1-ium-2-ylamino)-thiophen-2-ylmethyl]quinolin-8-ol |
|---|---|
| PubChem CID | 3625041 |
| Molecular Formula | C19H16N3OS+ |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 7-[(pyridin-1-ium-2-ylamino)-thiophen-2-ylmethyl]quinolin-8-ol |
| SMILES | Oc1c(C(Nc2cccc[nH+]2)c2cccs2)ccc2cccnc12 |
| InChI | InChI=1S/C19H15N3OS/c23-19-14(9-8-13-5-3-11-21-17(13)19)18(15-6-4-12-24-15)22-16-7-1-2-10-20-16/h1-12,18,23H,(H,20,22)/p+1 |
| InChIKey | ICJKSTJCIAGPIS-UHFFFAOYSA-O |
| XLogP | 4.02 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|