C25H24N2O4S — CID 19233065
2-ethoxyethyl 4-[[(8-hydroxyquinolin-7-yl)-thiophen-2-ylmethyl]amino]benzoate (PubChem CID 19233065) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-ethoxyethyl 4-[[(8-hydroxyquinolin-7-yl)-thiophen-2-ylmethyl]amino]benzoate.
| Compound Name | 2-ethoxyethyl 4-[[(8-hydroxyquinolin-7-yl)-thiophen-2-ylmethyl]amino]benzoate |
|---|---|
| PubChem CID | 19233065 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 2-ethoxyethyl 4-[[(8-hydroxyquinolin-7-yl)-thiophen-2-ylmethyl]amino]benzoate |
| SMILES | CCOCCOC(=O)c1ccc(NC(c2cccs2)c2ccc3cccnc3c2O)cc1 |
| InChI | InChI=1S/C25H24N2O4S/c1-2-30-14-15-31-25(29)18-7-10-19(11-8-18)27-23(21-6-4-16-32-21)20-12-9-17-5-3-13-26-22(17)24(20)28/h3-13,16,23,27-28H,2,14-15H2,1H3 |
| InChIKey | TXTWNDACUPIRTH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|