C26H25N3O4 — CID 19233013
2-methoxyethyl 4-[[(8-hydroxy-2-methylquinolin-7-yl)-pyridin-2-ylmethyl]amino]benzoate (PubChem CID 19233013) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-methoxyethyl 4-[[(8-hydroxy-2-methylquinolin-7-yl)-pyridin-2-ylmethyl]amino]benzoate.
| Compound Name | 2-methoxyethyl 4-[[(8-hydroxy-2-methylquinolin-7-yl)-pyridin-2-ylmethyl]amino]benzoate |
|---|---|
| PubChem CID | 19233013 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-methoxyethyl 4-[[(8-hydroxy-2-methylquinolin-7-yl)-pyridin-2-ylmethyl]amino]benzoate |
| SMILES | COCCOC(=O)c1ccc(NC(c2ccccn2)c2ccc3ccc(C)nc3c2O)cc1 |
| InChI | InChI=1S/C26H25N3O4/c1-17-6-7-18-10-13-21(25(30)23(18)28-17)24(22-5-3-4-14-27-22)29-20-11-8-19(9-12-20)26(31)33-16-15-32-2/h3-14,24,29-30H,15-16H2,1-2H3 |
| InChIKey | SJBGTCASYOGYTA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|