C25H22N2O3 — CID 23851621
ethyl 4-[anilino-(8-hydroxyquinolin-7-yl)methyl]benzoate (PubChem CID 23851621) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is ethyl 4-[anilino-(8-hydroxyquinolin-7-yl)methyl]benzoate.
| Compound Name | ethyl 4-[anilino-(8-hydroxyquinolin-7-yl)methyl]benzoate |
|---|---|
| PubChem CID | 23851621 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | ethyl 4-[anilino-(8-hydroxyquinolin-7-yl)methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(Nc2ccccc2)c2ccc3cccnc3c2O)cc1 |
| InChI | InChI=1S/C25H22N2O3/c1-2-30-25(29)19-12-10-18(11-13-19)22(27-20-8-4-3-5-9-20)21-15-14-17-7-6-16-26-23(17)24(21)28/h3-16,22,27-28H,2H2,1H3 |
| InChIKey | NWDLOIBCCPWSMB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|