C24H20ClN3O3 — CID 174319482
ethyl 4-[(5-chloro-8-hydroxyquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzoate (PubChem CID 174319482) has the molecular formula C24H20ClN3O3 and a molecular weight of 433.90 g/mol. Its IUPAC name is ethyl 4-[(5-chloro-8-hydroxyquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzoate.
| Compound Name | ethyl 4-[(5-chloro-8-hydroxyquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzoate |
|---|---|
| PubChem CID | 174319482 |
| Molecular Formula | C24H20ClN3O3 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | ethyl 4-[(5-chloro-8-hydroxyquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(Nc2ccccn2)c2cc(Cl)c3cccnc3c2O)cc1 |
| InChI | InChI=1S/C24H20ClN3O3/c1-2-31-24(30)16-10-8-15(9-11-16)21(28-20-7-3-4-12-26-20)18-14-19(25)17-6-5-13-27-22(17)23(18)29/h3-14,21,29H,2H2,1H3,(H,26,28) |
| InChIKey | VOFLQKYDSNSBET-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|