C25H21N3O5 — CID 67126854
ethyl 4-[[(8-hydroxyquinolin-7-yl)-(4-nitrophenyl)methyl]amino]benzoate (PubChem CID 67126854) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is ethyl 4-[[(8-hydroxyquinolin-7-yl)-(4-nitrophenyl)methyl]amino]benzoate.
| Compound Name | ethyl 4-[[(8-hydroxyquinolin-7-yl)-(4-nitrophenyl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 67126854 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | ethyl 4-[[(8-hydroxyquinolin-7-yl)-(4-nitrophenyl)methyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(c2ccc([N+](=O)[O-])cc2)c2ccc3cccnc3c2O)cc1 |
| InChI | InChI=1S/C25H21N3O5/c1-2-33-25(30)18-5-10-19(11-6-18)27-22(17-7-12-20(13-8-17)28(31)32)21-14-9-16-4-3-15-26-23(16)24(21)29/h3-15,22,27,29H,2H2,1H3 |
| InChIKey | QLRLSXBUQXPQQE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|