C21H17N4O4+ — CID 7808519
7-[(R)-[(3-hydroxypyridin-1-ium-2-yl)amino]-(4-nitrophenyl)methyl]quinolin-8-ol (PubChem CID 7808519) has the molecular formula C21H17N4O4+ and a molecular weight of 389.39 g/mol. Its IUPAC name is 7-[(R)-[(3-hydroxypyridin-1-ium-2-yl)amino]-(4-nitrophenyl)methyl]quinolin-8-ol.
| Compound Name | 7-[(R)-[(3-hydroxypyridin-1-ium-2-yl)amino]-(4-nitrophenyl)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 7808519 |
| Molecular Formula | C21H17N4O4+ |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 7-[(R)-[(3-hydroxypyridin-1-ium-2-yl)amino]-(4-nitrophenyl)methyl]quinolin-8-ol |
| SMILES | O=[N+]([O-])c1ccc([C@@H](Nc2[nH+]cccc2O)c2ccc3cccnc3c2O)cc1 |
| InChI | InChI=1S/C21H16N4O4/c26-17-4-2-12-23-21(17)24-18(14-5-8-15(9-6-14)25(28)29)16-10-7-13-3-1-11-22-19(13)20(16)27/h1-12,18,26-27H,(H,23,24)/p+1/t18-/m1/s1 |
| InChIKey | XUWBUPJKQGWMNX-GOSISDBHSA-O |
| XLogP | 3.57 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|