About cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol)
cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol) (PubChem CID 10509772) has the molecular formula C44H34CdN6O6
and a molecular weight of 855.20 g/mol. Its IUPAC name is cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol).
Molecular Properties
| Compound Name | cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol) |
| PubChem CID | 10509772 |
| Molecular Formula | C44H34CdN6O6 |
| Molecular Weight | 855.20 g/mol |
| Exact Mass | 856.16 |
| IUPAC Name | cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol) |
| SMILES | O=[N+]([O-])c1cccc(NC(c2ccccc2)c2ccc3cccnc3c2O)c1.O=[N+]([O-])c1cccc(NC(c2ccccc2)c2ccc3cccnc3c2O)c1.[Cd] |
| InChI | InChI=1S/2C22H17N3O3.Cd/c2*26-22-19(12-11-16-8-5-13-23-21(16)22)20(15-6-2-1-3-7-15)24-17-9-4-10-18(14-17)25(27)28;/h2*1-14,20,24,26H; |
| InChIKey | QYQUCFNFAHCGSS-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 176.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 855.20 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol)?
The IUPAC name of cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol) (CID 10509772) is cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol).
What is the SMILES notation for cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol)?
The canonical SMILES for cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol) is O=[N+]([O-])c1cccc(NC(c2ccccc2)c2ccc3cccnc3c2O)c1.O=[N+]([O-])c1cccc(NC(c2ccccc2)c2ccc3cccnc3c2O)c1.[Cd].
What is the InChIKey of cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol)?
The InChIKey is QYQUCFNFAHCGSS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C22H17N3O3.Cd/c2*26-22-19(12-11-16-8-5-13-23-21(16)22)20(15-6-2-1-3-7-15)24-17-9-4-10-18(14-17)25(27)28;/h2*1-14,20,24,26H;.
What are the key properties of cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol)?
cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol) has a molecular weight of 855.20 g/mol, XLogP of 10.10, 10 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium;bis(7-[(3-nitroanilino)-phenylmethyl]quinolin-8-ol) is sourced from PubChem (CID 10509772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).