C23H19F3N3O+ — CID 7025586
7-[(S)-[(4-methylpyridin-1-ium-2-yl)amino]-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol (PubChem CID 7025586) has the molecular formula C23H19F3N3O+ and a molecular weight of 410.42 g/mol. Its IUPAC name is 7-[(S)-[(4-methylpyridin-1-ium-2-yl)amino]-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol.
| Compound Name | 7-[(S)-[(4-methylpyridin-1-ium-2-yl)amino]-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 7025586 |
| Molecular Formula | C23H19F3N3O+ |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 7-[(S)-[(4-methylpyridin-1-ium-2-yl)amino]-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol |
| SMILES | Cc1cc[nH+]c(N[C@@H](c2ccc(C(F)(F)F)cc2)c2ccc3cccnc3c2O)c1 |
| InChI | InChI=1S/C23H18F3N3O/c1-14-10-12-27-19(13-14)29-20(16-4-7-17(8-5-16)23(24,25)26)18-9-6-15-3-2-11-28-21(15)22(18)30/h2-13,20,30H,1H3,(H,27,29)/p+1/t20-/m0/s1 |
| InChIKey | NGAWFARRBBNJRI-FQEVSTJZSA-O |
| XLogP | 5.28 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|