C26H25N3O3 — CID 19232971
butyl 3-[[(8-hydroxyquinolin-7-yl)-pyridin-4-ylmethyl]amino]benzoate (PubChem CID 19232971) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is butyl 3-[[(8-hydroxyquinolin-7-yl)-pyridin-4-ylmethyl]amino]benzoate.
| Compound Name | butyl 3-[[(8-hydroxyquinolin-7-yl)-pyridin-4-ylmethyl]amino]benzoate |
|---|---|
| PubChem CID | 19232971 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | butyl 3-[[(8-hydroxyquinolin-7-yl)-pyridin-4-ylmethyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cccc(NC(c2ccncc2)c2ccc3cccnc3c2O)c1 |
| InChI | InChI=1S/C26H25N3O3/c1-2-3-16-32-26(31)20-6-4-8-21(17-20)29-23(19-11-14-27-15-12-19)22-10-9-18-7-5-13-28-24(18)25(22)30/h4-15,17,23,29-30H,2-3,16H2,1H3 |
| InChIKey | LGAHSNYYZWTTAH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|