C28H28N2O4 — CID 19233096
2-ethoxyethyl 3-[[(8-hydroxy-2-methylquinolin-7-yl)-phenylmethyl]amino]benzoate (PubChem CID 19233096) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-ethoxyethyl 3-[[(8-hydroxy-2-methylquinolin-7-yl)-phenylmethyl]amino]benzoate.
| Compound Name | 2-ethoxyethyl 3-[[(8-hydroxy-2-methylquinolin-7-yl)-phenylmethyl]amino]benzoate |
|---|---|
| PubChem CID | 19233096 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 2-ethoxyethyl 3-[[(8-hydroxy-2-methylquinolin-7-yl)-phenylmethyl]amino]benzoate |
| SMILES | CCOCCOC(=O)c1cccc(NC(c2ccccc2)c2ccc3ccc(C)nc3c2O)c1 |
| InChI | InChI=1S/C28H28N2O4/c1-3-33-16-17-34-28(32)22-10-7-11-23(18-22)30-25(20-8-5-4-6-9-20)24-15-14-21-13-12-19(2)29-26(21)27(24)31/h4-15,18,25,30-31H,3,16-17H2,1-2H3 |
| InChIKey | WKVFVUBTZZXITM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|