C26H25N3O2 — CID 2221510
7-[(S)-(3-cyclopentyloxyphenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol (PubChem CID 2221510) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 7-[(S)-(3-cyclopentyloxyphenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol.
| Compound Name | 7-[(S)-(3-cyclopentyloxyphenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 2221510 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 7-[(S)-(3-cyclopentyloxyphenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
| SMILES | Oc1c([C@@H](Nc2ccccn2)c2cccc(OC3CCCC3)c2)ccc2cccnc12 |
| InChI | InChI=1S/C26H25N3O2/c30-26-22(14-13-18-8-6-16-28-25(18)26)24(29-23-12-3-4-15-27-23)19-7-5-11-21(17-19)31-20-9-1-2-10-20/h3-8,11-17,20,24,30H,1-2,9-10H2,(H,27,29)/t24-/m0/s1 |
| InChIKey | GLUBUPGDNWUQTD-DEOSSOPVSA-N |
| XLogP | 5.86 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|