C25H20N4O2 — CID 174320658
[7-[(2-cyanophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-yl] propanoate (PubChem CID 174320658) has the molecular formula C25H20N4O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is [7-[(2-cyanophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-yl] propanoate.
| Compound Name | [7-[(2-cyanophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-yl] propanoate |
|---|---|
| PubChem CID | 174320658 |
| Molecular Formula | C25H20N4O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | [7-[(2-cyanophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-yl] propanoate |
| SMILES | CCC(=O)Oc1c(C(Nc2ccccn2)c2ccccc2C#N)ccc2cccnc12 |
| InChI | InChI=1S/C25H20N4O2/c1-2-22(30)31-25-20(13-12-17-9-7-15-28-23(17)25)24(29-21-11-5-6-14-27-21)19-10-4-3-8-18(19)16-26/h3-15,24H,2H2,1H3,(H,27,29) |
| InChIKey | PGINUPITOBMNMK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|