C21H20ClN3O2 — CID 176553841
[2-[(3-amino-2-chlorophenyl)-(pyridin-2-ylamino)methyl]phenyl] propanoate (PubChem CID 176553841) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is [2-[(3-amino-2-chlorophenyl)-(pyridin-2-ylamino)methyl]phenyl] propanoate.
| Compound Name | [2-[(3-amino-2-chlorophenyl)-(pyridin-2-ylamino)methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 176553841 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [2-[(3-amino-2-chlorophenyl)-(pyridin-2-ylamino)methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccccc1C(Nc1ccccn1)c1cccc(N)c1Cl |
| InChI | InChI=1S/C21H20ClN3O2/c1-2-19(26)27-17-11-4-3-8-14(17)21(25-18-12-5-6-13-24-18)15-9-7-10-16(23)20(15)22/h3-13,21H,2,23H2,1H3,(H,24,25) |
| InChIKey | HPWLIAYESBFISS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|