C23H17Cl2N3O3 — CID 174321396
2-[7-[(2,3-dichlorophenyl)-(pyridin-2-ylamino)methyl]-8-hydroxyquinolin-5-yl]acetic acid (PubChem CID 174321396) has the molecular formula C23H17Cl2N3O3 and a molecular weight of 454.31 g/mol. Its IUPAC name is 2-[7-[(2,3-dichlorophenyl)-(pyridin-2-ylamino)methyl]-8-hydroxyquinolin-5-yl]acetic acid.
| Compound Name | 2-[7-[(2,3-dichlorophenyl)-(pyridin-2-ylamino)methyl]-8-hydroxyquinolin-5-yl]acetic acid |
|---|---|
| PubChem CID | 174321396 |
| Molecular Formula | C23H17Cl2N3O3 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 2-[7-[(2,3-dichlorophenyl)-(pyridin-2-ylamino)methyl]-8-hydroxyquinolin-5-yl]acetic acid |
| SMILES | O=C(O)Cc1cc(C(Nc2ccccn2)c2cccc(Cl)c2Cl)c(O)c2ncccc12 |
| InChI | InChI=1S/C23H17Cl2N3O3/c24-17-7-3-5-15(20(17)25)21(28-18-8-1-2-9-26-18)16-11-13(12-19(29)30)14-6-4-10-27-22(14)23(16)31/h1-11,21,31H,12H2,(H,26,28)(H,29,30) |
| InChIKey | TXNYWKMPRYTRSQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|