C9H12N2O3 — CID 62005676
methyl 3-hydroxy-2-(pyridin-2-ylamino)propanoate (PubChem CID 62005676) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is methyl 3-hydroxy-2-(pyridin-2-ylamino)propanoate.
| Compound Name | methyl 3-hydroxy-2-(pyridin-2-ylamino)propanoate |
|---|---|
| PubChem CID | 62005676 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | methyl 3-hydroxy-2-(pyridin-2-ylamino)propanoate |
| SMILES | COC(=O)C(CO)Nc1ccccn1 |
| InChI | InChI=1S/C9H12N2O3/c1-14-9(13)7(6-12)11-8-4-2-3-5-10-8/h2-5,7,12H,6H2,1H3,(H,10,11) |
| InChIKey | SBPAMGFLHATXBU-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |