C13H17N3O5 — CID 166386107
(3S)-4-methoxy-4-oxo-3-[3-(pyridin-2-ylamino)propanoylamino]butanoic acid (PubChem CID 166386107) has the molecular formula C13H17N3O5 and a molecular weight of 295.29 g/mol. Its IUPAC name is (3S)-4-methoxy-4-oxo-3-[3-(pyridin-2-ylamino)propanoylamino]butanoic acid.
| Compound Name | (3S)-4-methoxy-4-oxo-3-[3-(pyridin-2-ylamino)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 166386107 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (3S)-4-methoxy-4-oxo-3-[3-(pyridin-2-ylamino)propanoylamino]butanoic acid |
| SMILES | COC(=O)[C@H](CC(=O)O)NC(=O)CCNc1ccccn1 |
| InChI | InChI=1S/C13H17N3O5/c1-21-13(20)9(8-12(18)19)16-11(17)5-7-15-10-4-2-3-6-14-10/h2-4,6,9H,5,7-8H2,1H3,(H,14,15)(H,16,17)(H,18,19)/t9-/m0/s1 |
| InChIKey | RYKKEOCVPXTWAX-VIFPVBQESA-N |
| XLogP | 0.02 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |