C30H31F3N4O6 — CID 69030271
3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]-3-(2,2,2-trifluoroacetyl)oxypropanoyl]amino]propanoic acid (PubChem CID 69030271) has the molecular formula C30H31F3N4O6 and a molecular weight of 600.59 g/mol. Its IUPAC name is 3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]-3-(2,2,2-trifluoroacetyl)oxypropanoyl]amino]propanoic acid.
| Compound Name | 3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]-3-(2,2,2-trifluoroacetyl)oxypropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 69030271 |
| Molecular Formula | C30H31F3N4O6 |
| Molecular Weight | 600.59 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | 3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]-3-(2,2,2-trifluoroacetyl)oxypropanoyl]amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)[C@H](COC(=O)C(F)(F)F)NC(=O)CCCCNc1ccccn1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H31F3N4O6/c31-30(32,33)29(42)43-19-24(36-26(38)11-5-7-17-35-25-10-4-6-16-34-25)28(41)37-23(18-27(39)40)22-14-12-21(13-15-22)20-8-2-1-3-9-20/h1-4,6,8-10,12-16,23-24H,5,7,11,17-19H2,(H,34,35)(H,36,38)(H,37,41)(H,39,40)/t23?,24-/m0/s1 |
| InChIKey | JTPLJXLQQLVQAI-CGAIIQECSA-N |
| XLogP | 4.25 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|