C34H34F3N5O6 — CID 69028576
3-(4-phenylphenyl)-3-[[(2R)-3-pyridin-4-yl-2-[4-(pyridin-2-ylamino)butanoylamino]propanoyl]amino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 69028576) has the molecular formula C34H34F3N5O6 and a molecular weight of 665.67 g/mol. Its IUPAC name is 3-(4-phenylphenyl)-3-[[(2R)-3-pyridin-4-yl-2-[4-(pyridin-2-ylamino)butanoylamino]propanoyl]amino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(4-phenylphenyl)-3-[[(2R)-3-pyridin-4-yl-2-[4-(pyridin-2-ylamino)butanoylamino]propanoyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69028576 |
| Molecular Formula | C34H34F3N5O6 |
| Molecular Weight | 665.67 g/mol |
| Exact Mass | 665.25 |
| IUPAC Name | 3-(4-phenylphenyl)-3-[[(2R)-3-pyridin-4-yl-2-[4-(pyridin-2-ylamino)butanoylamino]propanoyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CC(NC(=O)[C@@H](Cc1ccncc1)NC(=O)CCCNc1ccccn1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H33N5O4.C2HF3O2/c38-30(10-6-18-35-29-9-4-5-17-34-29)36-28(21-23-15-19-33-20-16-23)32(41)37-27(22-31(39)40)26-13-11-25(12-14-26)24-7-2-1-3-8-24;3-2(4,5)1(6)7/h1-5,7-9,11-17,19-20,27-28H,6,10,18,21-22H2,(H,34,35)(H,36,38)(H,37,41)(H,39,40);(H,6,7)/t27?,28-;/m1./s1 |
| InChIKey | NLAHHZFCXIGRAW-AMRYRHMLSA-N |
| XLogP | 5.03 |
| TPSA | 170.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|