C31H34N6O4 — CID 10187651
3-[[(2S)-3-(1H-imidazol-5-yl)-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 10187651) has the molecular formula C31H34N6O4 and a molecular weight of 554.65 g/mol. Its IUPAC name is 3-[[(2S)-3-(1H-imidazol-5-yl)-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 3-[[(2S)-3-(1H-imidazol-5-yl)-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 10187651 |
| Molecular Formula | C31H34N6O4 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 3-[[(2S)-3-(1H-imidazol-5-yl)-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CCCCNc1ccccn1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H34N6O4/c38-29(11-5-7-17-34-28-10-4-6-16-33-28)36-27(18-25-20-32-21-35-25)31(41)37-26(19-30(39)40)24-14-12-23(13-15-24)22-8-2-1-3-9-22/h1-4,6,8-10,12-16,20-21,26-27H,5,7,11,17-19H2,(H,32,35)(H,33,34)(H,36,38)(H,37,41)(H,39,40)/t26?,27-/m0/s1 |
| InChIKey | PRIZFANURVSDFS-GEVKEYJPSA-N |
| XLogP | 4.11 |
| TPSA | 149.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|